C17H16FNO3S — CID 124891791
N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-2-fluorobenzenesulfonamide (PubChem CID 124891791) has the molecular formula C17H16FNO3S and a molecular weight of 333.38 g/mol. Its IUPAC name is N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-2-fluorobenzenesulfonamide.
| Compound Name | N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-2-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 124891791 |
| Molecular Formula | C17H16FNO3S |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-2-fluorobenzenesulfonamide |
| SMILES | C[C@@H](Cc1cc2ccccc2o1)NS(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C17H16FNO3S/c1-12(10-14-11-13-6-2-4-8-16(13)22-14)19-23(20,21)17-9-5-3-7-15(17)18/h2-9,11-12,19H,10H2,1H3/t12-/m0/s1 |
| InChIKey | GQOQKNWBNSFMBH-LBPRGKRZSA-N |
| XLogP | 3.48 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |