C18H15ClFNO2 — CID 124892455
N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-2-chloro-6-fluorobenzamide (PubChem CID 124892455) has the molecular formula C18H15ClFNO2 and a molecular weight of 331.77 g/mol. Its IUPAC name is N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-2-chloro-6-fluorobenzamide.
| Compound Name | N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 124892455 |
| Molecular Formula | C18H15ClFNO2 |
| Molecular Weight | 331.77 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-2-chloro-6-fluorobenzamide |
| SMILES | C[C@@H](Cc1cc2ccccc2o1)NC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C18H15ClFNO2/c1-11(9-13-10-12-5-2-3-8-16(12)23-13)21-18(22)17-14(19)6-4-7-15(17)20/h2-8,10-11H,9H2,1H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | RDWKESQTXKAVDF-NSHDSACASA-N |
| XLogP | 4.59 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.77 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |