C19H16N2O2 — CID 124761350
N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-3-cyanobenzamide (PubChem CID 124761350) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-3-cyanobenzamide.
| Compound Name | N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-3-cyanobenzamide |
|---|---|
| PubChem CID | 124761350 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | N-[(2S)-1-(1-benzofuran-2-yl)propan-2-yl]-3-cyanobenzamide |
| SMILES | C[C@@H](Cc1cc2ccccc2o1)NC(=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H16N2O2/c1-13(9-17-11-15-6-2-3-8-18(15)23-17)21-19(22)16-7-4-5-14(10-16)12-20/h2-8,10-11,13H,9H2,1H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | YNAYVVAYQJPREY-ZDUSSCGKSA-N |
| XLogP | 3.67 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |