C18H18FNO3S — CID 121021353
N-[1-(1-benzofuran-2-yl)propan-2-yl]-4-fluoro-2-methylbenzenesulfonamide (PubChem CID 121021353) has the molecular formula C18H18FNO3S and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[1-(1-benzofuran-2-yl)propan-2-yl]-4-fluoro-2-methylbenzenesulfonamide.
| Compound Name | N-[1-(1-benzofuran-2-yl)propan-2-yl]-4-fluoro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 121021353 |
| Molecular Formula | C18H18FNO3S |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | N-[1-(1-benzofuran-2-yl)propan-2-yl]-4-fluoro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NC(C)Cc1cc2ccccc2o1 |
| InChI | InChI=1S/C18H18FNO3S/c1-12-9-15(19)7-8-18(12)24(21,22)20-13(2)10-16-11-14-5-3-4-6-17(14)23-16/h3-9,11,13,20H,10H2,1-2H3 |
| InChIKey | AYQHOQNPBSWMOL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |