C10H10O4S — CID 87653215
1-(1-benzofuran-2-yl)ethanesulfonic acid (PubChem CID 87653215) has the molecular formula C10H10O4S and a molecular weight of 226.25 g/mol. Its IUPAC name is 1-(1-benzofuran-2-yl)ethanesulfonic acid.
| Compound Name | 1-(1-benzofuran-2-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 87653215 |
| Molecular Formula | C10H10O4S |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.03 |
| IUPAC Name | 1-(1-benzofuran-2-yl)ethanesulfonic acid |
| SMILES | CC(c1cc2ccccc2o1)S(=O)(=O)O |
| InChI | InChI=1S/C10H10O4S/c1-7(15(11,12)13)10-6-8-4-2-3-5-9(8)14-10/h2-7H,1H3,(H,11,12,13) |
| InChIKey | KALWWEYGNXARPK-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|