C21H26N4O3 — CID 59242342
methyl (E)-3-[5-[[(2R)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 59242342) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is methyl (E)-3-[5-[[(2R)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-[[(2R)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59242342 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | methyl (E)-3-[5-[[(2R)-3-methyl-1-oxo-1-(2-phenylethylamino)butan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cnc(N[C@@H](C(=O)NCCc2ccccc2)C(C)C)cn1 |
| InChI | InChI=1S/C21H26N4O3/c1-15(2)20(21(27)22-12-11-16-7-5-4-6-8-16)25-18-14-23-17(13-24-18)9-10-19(26)28-3/h4-10,13-15,20H,11-12H2,1-3H3,(H,22,27)(H,24,25)/b10-9+/t20-/m1/s1 |
| InChIKey | QDZIRHPCRUIHJF-SQUSKLHYSA-N |
| XLogP | 2.46 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|