C17H18N4O3 — CID 59242357
methyl (E)-3-[5-[[(2R)-1-anilino-1-oxopropan-2-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 59242357) has the molecular formula C17H18N4O3 and a molecular weight of 326.36 g/mol. Its IUPAC name is methyl (E)-3-[5-[[(2R)-1-anilino-1-oxopropan-2-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[5-[[(2R)-1-anilino-1-oxopropan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 59242357 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | methyl (E)-3-[5-[[(2R)-1-anilino-1-oxopropan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1cnc(N[C@H](C)C(=O)Nc2ccccc2)cn1 |
| InChI | InChI=1S/C17H18N4O3/c1-12(17(23)21-13-6-4-3-5-7-13)20-15-11-18-14(10-19-15)8-9-16(22)24-2/h3-12H,1-2H3,(H,19,20)(H,21,23)/b9-8+/t12-/m1/s1 |
| InChIKey | SWSIRQJQIXURBK-IDVQTMNDSA-N |
| XLogP | 2.10 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|