C18H21N3O4 — CID 91236290
methyl 3-[5-[[(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl]amino]pyrazin-2-yl]prop-2-enoate (PubChem CID 91236290) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is methyl 3-[5-[[(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl]amino]pyrazin-2-yl]prop-2-enoate.
| Compound Name | methyl 3-[5-[[(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 91236290 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | methyl 3-[5-[[(2R)-1-hydroxy-3-phenylmethoxypropan-2-yl]amino]pyrazin-2-yl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1cnc(N[C@H](CO)COCc2ccccc2)cn1 |
| InChI | InChI=1S/C18H21N3O4/c1-24-18(23)8-7-15-9-20-17(10-19-15)21-16(11-22)13-25-12-14-5-3-2-4-6-14/h2-10,16,22H,11-13H2,1H3,(H,20,21)/t16-/m1/s1 |
| InChIKey | BDBGOWYVNWUKLS-MRXNPFEDSA-N |
| XLogP | 1.65 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|