C25H35FN4O3 — CID 91362236
3-[5-fluoro-6-[[(3R)-1-oct-2-ynylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide (PubChem CID 91362236) has the molecular formula C25H35FN4O3 and a molecular weight of 458.58 g/mol. Its IUPAC name is 3-[5-fluoro-6-[[(3R)-1-oct-2-ynylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide.
| Compound Name | 3-[5-fluoro-6-[[(3R)-1-oct-2-ynylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
|---|---|
| PubChem CID | 91362236 |
| Molecular Formula | C25H35FN4O3 |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.27 |
| IUPAC Name | 3-[5-fluoro-6-[[(3R)-1-oct-2-ynylpyrrolidin-3-yl]amino]-3-pyridinyl]-N-(oxan-2-yloxy)prop-2-enamide |
| SMILES | CCCCCC#CCN1CC[C@@H](Nc2ncc(C=CC(=O)NOC3CCCCO3)cc2F)C1 |
| InChI | InChI=1S/C25H35FN4O3/c1-2-3-4-5-6-8-14-30-15-13-21(19-30)28-25-22(26)17-20(18-27-25)11-12-23(31)29-33-24-10-7-9-16-32-24/h11-12,17-18,21,24H,2-5,7,9-10,13-16,19H2,1H3,(H,27,28)(H,29,31)/t21-,24?/m1/s1 |
| InChIKey | SWTHDUCPKROLEK-CILPGNKCSA-N |
| XLogP | 3.88 |
| TPSA | 75.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|