C31H32N4O6 — CID 157251510
N-[14-methyl-9-[[4-[2-(oxan-2-yloxy)acetyl]phenyl]methyl]-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-6-yl]prop-2-enamide (PubChem CID 157251510) has the molecular formula C31H32N4O6 and a molecular weight of 556.62 g/mol. Its IUPAC name is N-[14-methyl-9-[[4-[2-(oxan-2-yloxy)acetyl]phenyl]methyl]-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-6-yl]prop-2-enamide.
| Compound Name | N-[14-methyl-9-[[4-[2-(oxan-2-yloxy)acetyl]phenyl]methyl]-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-6-yl]prop-2-enamide |
|---|---|
| PubChem CID | 157251510 |
| Molecular Formula | C31H32N4O6 |
| Molecular Weight | 556.62 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | N-[14-methyl-9-[[4-[2-(oxan-2-yloxy)acetyl]phenyl]methyl]-13,15-dioxo-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-6-yl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1ccc2c3c(n(Cc4ccc(C(=O)COC5CCCCO5)cc4)c2c1)CN1CC3C(=O)N(C)C1=O |
| InChI | InChI=1S/C31H32N4O6/c1-3-27(37)32-21-11-12-22-24(14-21)35(25-17-34-16-23(29(22)25)30(38)33(2)31(34)39)15-19-7-9-20(10-8-19)26(36)18-41-28-6-4-5-13-40-28/h3,7-12,14,23,28H,1,4-6,13,15-18H2,2H3,(H,32,37) |
| InChIKey | AWJZUJUFZNNBON-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.62 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|