C25H25N3O5 — CID 130238383
4-[(14-methyl-13,15-dioxo-5-propoxy-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzoic acid (PubChem CID 130238383) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-[(14-methyl-13,15-dioxo-5-propoxy-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzoic acid.
| Compound Name | 4-[(14-methyl-13,15-dioxo-5-propoxy-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 130238383 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | 4-[(14-methyl-13,15-dioxo-5-propoxy-9,12,14-triazatetracyclo[10.3.1.02,10.03,8]hexadeca-2(10),3(8),4,6-tetraen-9-yl)methyl]benzoic acid |
| SMILES | CCCOc1ccc2c(c1)c1c(n2Cc2ccc(C(=O)O)cc2)CN2CC1C(=O)N(C)C2=O |
| InChI | InChI=1S/C25H25N3O5/c1-3-10-33-17-8-9-20-18(11-17)22-19-13-27(25(32)26(2)23(19)29)14-21(22)28(20)12-15-4-6-16(7-5-15)24(30)31/h4-9,11,19H,3,10,12-14H2,1-2H3,(H,30,31) |
| InChIKey | FHXCEUUMYVKFEF-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|