C38H50N2O7 — CID 153406433
1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-(2-methoxyethoxymethoxy)-2-[4-(2-methoxyethoxymethoxy)phenyl]-3-methylindole (PubChem CID 153406433) has the molecular formula C38H50N2O7 and a molecular weight of 646.82 g/mol. Its IUPAC name is 1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-(2-methoxyethoxymethoxy)-2-[4-(2-methoxyethoxymethoxy)phenyl]-3-methylindole.
| Compound Name | 1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-(2-methoxyethoxymethoxy)-2-[4-(2-methoxyethoxymethoxy)phenyl]-3-methylindole |
|---|---|
| PubChem CID | 153406433 |
| Molecular Formula | C38H50N2O7 |
| Molecular Weight | 646.82 g/mol |
| Exact Mass | 646.36 |
| IUPAC Name | 1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-(2-methoxyethoxymethoxy)-2-[4-(2-methoxyethoxymethoxy)phenyl]-3-methylindole |
| SMILES | COCCOCOc1ccc(-c2c(C)c3cc(OCOCCOC)ccc3n2Cc2ccc(OCCN3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C38H50N2O7/c1-30-36-26-35(47-29-44-25-23-42-3)16-17-37(36)40(38(30)32-10-14-34(15-11-32)46-28-43-24-22-41-2)27-31-8-12-33(13-9-31)45-21-20-39-18-6-4-5-7-19-39/h8-17,26H,4-7,18-25,27-29H2,1-3H3 |
| InChIKey | AFVYEZPKLRFREW-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 72.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.82 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|