C38H50N2O5 — CID 153406432
1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-(2-ethoxyethoxy)-2-[4-(2-ethoxyethoxy)phenyl]-3-methylindole (PubChem CID 153406432) has the molecular formula C38H50N2O5 and a molecular weight of 614.83 g/mol. Its IUPAC name is 1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-(2-ethoxyethoxy)-2-[4-(2-ethoxyethoxy)phenyl]-3-methylindole.
| Compound Name | 1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-(2-ethoxyethoxy)-2-[4-(2-ethoxyethoxy)phenyl]-3-methylindole |
|---|---|
| PubChem CID | 153406432 |
| Molecular Formula | C38H50N2O5 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.37 |
| IUPAC Name | 1-[[4-[2-(azepan-1-yl)ethoxy]phenyl]methyl]-5-(2-ethoxyethoxy)-2-[4-(2-ethoxyethoxy)phenyl]-3-methylindole |
| SMILES | CCOCCOc1ccc(-c2c(C)c3cc(OCCOCC)ccc3n2Cc2ccc(OCCN3CCCCCC3)cc2)cc1 |
| InChI | InChI=1S/C38H50N2O5/c1-4-41-24-26-44-34-16-12-32(13-17-34)38-30(3)36-28-35(45-27-25-42-5-2)18-19-37(36)40(38)29-31-10-14-33(15-11-31)43-23-22-39-20-8-6-7-9-21-39/h10-19,28H,4-9,20-27,29H2,1-3H3 |
| InChIKey | METSSEYEDLWTOI-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 54.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|