C35H36N2O2 — CID 174448613
4-[4-[3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-2-yl]phenyl]phenol (PubChem CID 174448613) has the molecular formula C35H36N2O2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 4-[4-[3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-2-yl]phenyl]phenol.
| Compound Name | 4-[4-[3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-2-yl]phenyl]phenol |
|---|---|
| PubChem CID | 174448613 |
| Molecular Formula | C35H36N2O2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 4-[4-[3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]indol-2-yl]phenyl]phenol |
| SMILES | Cc1c(-c2ccc(-c3ccc(O)cc3)cc2)n(Cc2ccc(OCCN3CCCCC3)cc2)c2ccccc12 |
| InChI | InChI=1S/C35H36N2O2/c1-26-33-7-3-4-8-34(33)37(35(26)30-13-11-28(12-14-30)29-15-17-31(38)18-16-29)25-27-9-19-32(20-10-27)39-24-23-36-21-5-2-6-22-36/h3-4,7-20,38H,2,5-6,21-25H2,1H3 |
| InChIKey | FJNHCMZRWYFXCC-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |