C32H38N2O2 — CID 91000508
3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-2-(4-propan-2-yloxyphenyl)indole (PubChem CID 91000508) has the molecular formula C32H38N2O2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-2-(4-propan-2-yloxyphenyl)indole.
| Compound Name | 3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-2-(4-propan-2-yloxyphenyl)indole |
|---|---|
| PubChem CID | 91000508 |
| Molecular Formula | C32H38N2O2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 3-methyl-1-[[4-(2-piperidin-1-ylethoxy)phenyl]methyl]-2-(4-propan-2-yloxyphenyl)indole |
| SMILES | Cc1c(-c2ccc(OC(C)C)cc2)n(Cc2ccc(OCCN3CCCCC3)cc2)c2ccccc12 |
| InChI | InChI=1S/C32H38N2O2/c1-24(2)36-29-17-13-27(14-18-29)32-25(3)30-9-5-6-10-31(30)34(32)23-26-11-15-28(16-12-26)35-22-21-33-19-7-4-8-20-33/h5-6,9-18,24H,4,7-8,19-23H2,1-3H3 |
| InChIKey | OHNWRFYEWYWZHD-UHFFFAOYSA-N |
| XLogP | 7.32 |
| TPSA | 26.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |