C34H34BrNO3 — CID 15545816
1-[[4-(2-bromoethoxy)phenyl]methyl]-3-methyl-5-phenylmethoxy-2-(4-propan-2-yloxyphenyl)indole (PubChem CID 15545816) has the molecular formula C34H34BrNO3 and a molecular weight of 584.55 g/mol. Its IUPAC name is 1-[[4-(2-bromoethoxy)phenyl]methyl]-3-methyl-5-phenylmethoxy-2-(4-propan-2-yloxyphenyl)indole.
| Compound Name | 1-[[4-(2-bromoethoxy)phenyl]methyl]-3-methyl-5-phenylmethoxy-2-(4-propan-2-yloxyphenyl)indole |
|---|---|
| PubChem CID | 15545816 |
| Molecular Formula | C34H34BrNO3 |
| Molecular Weight | 584.55 g/mol |
| Exact Mass | 583.17 |
| IUPAC Name | 1-[[4-(2-bromoethoxy)phenyl]methyl]-3-methyl-5-phenylmethoxy-2-(4-propan-2-yloxyphenyl)indole |
| SMILES | Cc1c(-c2ccc(OC(C)C)cc2)n(Cc2ccc(OCCBr)cc2)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C34H34BrNO3/c1-24(2)39-30-15-11-28(12-16-30)34-25(3)32-21-31(38-23-27-7-5-4-6-8-27)17-18-33(32)36(34)22-26-9-13-29(14-10-26)37-20-19-35/h4-18,21,24H,19-20,22-23H2,1-3H3 |
| InChIKey | JPIKWBQYPMEEES-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 32.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.55 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|