C44H44N2O4 — CID 87135433
2-(azepan-1-yl)-2-[4-[[3-methyl-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)indol-1-yl]methyl]phenoxy]acetaldehyde (PubChem CID 87135433) has the molecular formula C44H44N2O4 and a molecular weight of 664.85 g/mol. Its IUPAC name is 2-(azepan-1-yl)-2-[4-[[3-methyl-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)indol-1-yl]methyl]phenoxy]acetaldehyde.
| Compound Name | 2-(azepan-1-yl)-2-[4-[[3-methyl-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)indol-1-yl]methyl]phenoxy]acetaldehyde |
|---|---|
| PubChem CID | 87135433 |
| Molecular Formula | C44H44N2O4 |
| Molecular Weight | 664.85 g/mol |
| Exact Mass | 664.33 |
| IUPAC Name | 2-(azepan-1-yl)-2-[4-[[3-methyl-5-phenylmethoxy-2-(4-phenylmethoxyphenyl)indol-1-yl]methyl]phenoxy]acetaldehyde |
| SMILES | Cc1c(-c2ccc(OCc3ccccc3)cc2)n(Cc2ccc(OC(C=O)N3CCCCCC3)cc2)c2ccc(OCc3ccccc3)cc12 |
| InChI | InChI=1S/C44H44N2O4/c1-33-41-28-40(49-32-36-14-8-5-9-15-36)24-25-42(41)46(44(33)37-18-22-38(23-19-37)48-31-35-12-6-4-7-13-35)29-34-16-20-39(21-17-34)50-43(30-47)45-26-10-2-3-11-27-45/h4-9,12-25,28,30,43H,2-3,10-11,26-27,29,31-32H2,1H3 |
| InChIKey | KCGCZDJPZWCDOK-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.85 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|