C39H42FNO7 — CID 134327355
ethyl 2-[2-[2-[2-[4-[[2-(4-fluorophenyl)-3-methyl-5-phenylmethoxyindol-1-yl]methyl]phenoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 134327355) has the molecular formula C39H42FNO7 and a molecular weight of 655.76 g/mol. Its IUPAC name is ethyl 2-[2-[2-[2-[4-[[2-(4-fluorophenyl)-3-methyl-5-phenylmethoxyindol-1-yl]methyl]phenoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | ethyl 2-[2-[2-[2-[4-[[2-(4-fluorophenyl)-3-methyl-5-phenylmethoxyindol-1-yl]methyl]phenoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 134327355 |
| Molecular Formula | C39H42FNO7 |
| Molecular Weight | 655.76 g/mol |
| Exact Mass | 655.29 |
| IUPAC Name | ethyl 2-[2-[2-[2-[4-[[2-(4-fluorophenyl)-3-methyl-5-phenylmethoxyindol-1-yl]methyl]phenoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | CCOC(=O)COCCOCCOCCOc1ccc(Cn2c(-c3ccc(F)cc3)c(C)c3cc(OCc4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C39H42FNO7/c1-3-46-38(42)28-45-22-21-43-19-20-44-23-24-47-34-15-9-30(10-16-34)26-41-37-18-17-35(48-27-31-7-5-4-6-8-31)25-36(37)29(2)39(41)32-11-13-33(40)14-12-32/h4-18,25H,3,19-24,26-28H2,1-2H3 |
| InChIKey | PEKJUFBDJAXAQV-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 77.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.76 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|