C19H24N2O2 — CID 91392559
ethyl 2-(7-methyl-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-3-yl)acetate (PubChem CID 91392559) has the molecular formula C19H24N2O2 and a molecular weight of 312.41 g/mol. Its IUPAC name is ethyl 2-(7-methyl-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-3-yl)acetate.
| Compound Name | ethyl 2-(7-methyl-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-3-yl)acetate |
|---|---|
| PubChem CID | 91392559 |
| Molecular Formula | C19H24N2O2 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | ethyl 2-(7-methyl-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraen-3-yl)acetate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(C)ccc31)CN1CCC2CC1 |
| InChI | InChI=1S/C19H24N2O2/c1-3-23-18(22)12-21-17-5-4-13(2)10-15(17)16-11-20-8-6-14(7-9-20)19(16)21/h4-5,10,14H,3,6-9,11-12H2,1-2H3 |
| InChIKey | FBJUIMAHJMBWOS-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |