C24H25F3N2 — CID 45380570
7-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene (PubChem CID 45380570) has the molecular formula C24H25F3N2 and a molecular weight of 398.47 g/mol. Its IUPAC name is 7-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene.
| Compound Name | 7-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 45380570 |
| Molecular Formula | C24H25F3N2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 7-methyl-3-[2-[3-(trifluoromethyl)phenyl]ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2cccc(C(F)(F)F)c2)C2CCN(CC2)C1 |
| InChI | InChI=1S/C24H25F3N2/c1-16-5-6-22-20(13-16)21-15-28-10-8-18(9-11-28)23(21)29(22)12-7-17-3-2-4-19(14-17)24(25,26)27/h2-6,13-14,18H,7-12,15H2,1H3 |
| InChIKey | AKKPEJBXBPHZDD-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |