C23H24F3N3 — CID 45380666
7-methyl-3-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene (PubChem CID 45380666) has the molecular formula C23H24F3N3 and a molecular weight of 399.46 g/mol. Its IUPAC name is 7-methyl-3-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene.
| Compound Name | 7-methyl-3-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 45380666 |
| Molecular Formula | C23H24F3N3 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 7-methyl-3-[2-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-3,12-diazatetracyclo[10.2.2.02,10.04,9]hexadeca-2(10),4(9),5,7-tetraene |
| SMILES | Cc1ccc2c(c1)c1c(n2CCc2ccc(C(F)(F)F)nc2)C2CCN(CC2)C1 |
| InChI | InChI=1S/C23H24F3N3/c1-15-2-4-20-18(12-15)19-14-28-9-7-17(8-10-28)22(19)29(20)11-6-16-3-5-21(27-13-16)23(24,25)26/h2-5,12-13,17H,6-11,14H2,1H3 |
| InChIKey | DDMVZAVSTDMVQZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |