C26H27F3N2O — CID 67881191
1-(1-methylindol-3-yl)-3-[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]prop-2-en-1-one (PubChem CID 67881191) has the molecular formula C26H27F3N2O and a molecular weight of 440.51 g/mol. Its IUPAC name is 1-(1-methylindol-3-yl)-3-[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]prop-2-en-1-one.
| Compound Name | 1-(1-methylindol-3-yl)-3-[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 67881191 |
| Molecular Formula | C26H27F3N2O |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 1-(1-methylindol-3-yl)-3-[1-[2-[3-(trifluoromethyl)phenyl]ethyl]piperidin-4-yl]prop-2-en-1-one |
| SMILES | Cn1cc(C(=O)C=CC2CCN(CCc3cccc(C(F)(F)F)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C26H27F3N2O/c1-30-18-23(22-7-2-3-8-24(22)30)25(32)10-9-19-11-14-31(15-12-19)16-13-20-5-4-6-21(17-20)26(27,28)29/h2-10,17-19H,11-16H2,1H3 |
| InChIKey | JONTWDWHTVCKRF-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|