C25H29FN2O — CID 10069100
3-[1-[[3-(fluoromethyl)phenyl]methyl]piperidin-4-yl]-1-(1-methylindol-3-yl)propan-1-one (PubChem CID 10069100) has the molecular formula C25H29FN2O and a molecular weight of 392.52 g/mol. Its IUPAC name is 3-[1-[[3-(fluoromethyl)phenyl]methyl]piperidin-4-yl]-1-(1-methylindol-3-yl)propan-1-one.
| Compound Name | 3-[1-[[3-(fluoromethyl)phenyl]methyl]piperidin-4-yl]-1-(1-methylindol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 10069100 |
| Molecular Formula | C25H29FN2O |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 3-[1-[[3-(fluoromethyl)phenyl]methyl]piperidin-4-yl]-1-(1-methylindol-3-yl)propan-1-one |
| SMILES | Cn1cc(C(=O)CCC2CCN(Cc3cccc(CF)c3)CC2)c2ccccc21 |
| InChI | InChI=1S/C25H29FN2O/c1-27-18-23(22-7-2-3-8-24(22)27)25(29)10-9-19-11-13-28(14-12-19)17-21-6-4-5-20(15-21)16-26/h2-8,15,18-19H,9-14,16-17H2,1H3 |
| InChIKey | KMKYWOVDHUEDBV-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |