C24H27FN2O — CID 10429753
3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-1-(1-methylindol-3-yl)propan-1-one (PubChem CID 10429753) has the molecular formula C24H27FN2O and a molecular weight of 378.49 g/mol. Its IUPAC name is 3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-1-(1-methylindol-3-yl)propan-1-one.
| Compound Name | 3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-1-(1-methylindol-3-yl)propan-1-one |
|---|---|
| PubChem CID | 10429753 |
| Molecular Formula | C24H27FN2O |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 3-[1-[(4-fluorophenyl)methyl]piperidin-4-yl]-1-(1-methylindol-3-yl)propan-1-one |
| SMILES | Cn1cc(C(=O)CCC2CCN(Cc3ccc(F)cc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H27FN2O/c1-26-17-22(21-4-2-3-5-23(21)26)24(28)11-8-18-12-14-27(15-13-18)16-19-6-9-20(25)10-7-19/h2-7,9-10,17-18H,8,11-16H2,1H3 |
| InChIKey | ASKXEJJVRJLRGM-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |