C25H27FN2O — CID 174320699
1-(5-fluoro-1-methylindol-3-yl)-3-[1-(2-phenylethenyl)piperidin-4-yl]propan-1-one (PubChem CID 174320699) has the molecular formula C25H27FN2O and a molecular weight of 390.50 g/mol. Its IUPAC name is 1-(5-fluoro-1-methylindol-3-yl)-3-[1-(2-phenylethenyl)piperidin-4-yl]propan-1-one.
| Compound Name | 1-(5-fluoro-1-methylindol-3-yl)-3-[1-(2-phenylethenyl)piperidin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 174320699 |
| Molecular Formula | C25H27FN2O |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-(5-fluoro-1-methylindol-3-yl)-3-[1-(2-phenylethenyl)piperidin-4-yl]propan-1-one |
| SMILES | Cn1cc(C(=O)CCC2CCN(C=Cc3ccccc3)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C25H27FN2O/c1-27-18-23(22-17-21(26)8-9-24(22)27)25(29)10-7-20-12-15-28(16-13-20)14-11-19-5-3-2-4-6-19/h2-6,8-9,11,14,17-18,20H,7,10,12-13,15-16H2,1H3 |
| InChIKey | AHGDZXIXTBDZBK-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |