C19H24N2O3 — CID 124697845
3-[(3R)-1-[2-(1-methylindol-3-yl)acetyl]piperidin-3-yl]propanoic acid (PubChem CID 124697845) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[(3R)-1-[2-(1-methylindol-3-yl)acetyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R)-1-[2-(1-methylindol-3-yl)acetyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 124697845 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 3-[(3R)-1-[2-(1-methylindol-3-yl)acetyl]piperidin-3-yl]propanoic acid |
| SMILES | Cn1cc(CC(=O)N2CCC[C@H](CCC(=O)O)C2)c2ccccc21 |
| InChI | InChI=1S/C19H24N2O3/c1-20-13-15(16-6-2-3-7-17(16)20)11-18(22)21-10-4-5-14(12-21)8-9-19(23)24/h2-3,6-7,13-14H,4-5,8-12H2,1H3,(H,23,24)/t14-/m1/s1 |
| InChIKey | KLEWKPSXMZVMCM-CQSZACIVSA-N |
| XLogP | 2.82 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |