C20H22N4O3 — CID 97252996
1-[(3R)-1-[2-(1-methylindol-3-yl)acetyl]piperidin-3-yl]pyrazole-4-carboxylic acid (PubChem CID 97252996) has the molecular formula C20H22N4O3 and a molecular weight of 366.42 g/mol. Its IUPAC name is 1-[(3R)-1-[2-(1-methylindol-3-yl)acetyl]piperidin-3-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[(3R)-1-[2-(1-methylindol-3-yl)acetyl]piperidin-3-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 97252996 |
| Molecular Formula | C20H22N4O3 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 1-[(3R)-1-[2-(1-methylindol-3-yl)acetyl]piperidin-3-yl]pyrazole-4-carboxylic acid |
| SMILES | Cn1cc(CC(=O)N2CCC[C@@H](n3cc(C(=O)O)cn3)C2)c2ccccc21 |
| InChI | InChI=1S/C20H22N4O3/c1-22-11-14(17-6-2-3-7-18(17)22)9-19(25)23-8-4-5-16(13-23)24-12-15(10-21-24)20(26)27/h2-3,6-7,10-12,16H,4-5,8-9,13H2,1H3,(H,26,27)/t16-/m1/s1 |
| InChIKey | OCJGYYLXWLYFGQ-MRXNPFEDSA-N |
| XLogP | 2.48 |
| TPSA | 80.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |