C23H26N2O — CID 129409350
2-(1-methylindol-3-yl)-1-[(3S)-3-phenylazepan-1-yl]ethanone (PubChem CID 129409350) has the molecular formula C23H26N2O and a molecular weight of 346.47 g/mol. Its IUPAC name is 2-(1-methylindol-3-yl)-1-[(3S)-3-phenylazepan-1-yl]ethanone.
| Compound Name | 2-(1-methylindol-3-yl)-1-[(3S)-3-phenylazepan-1-yl]ethanone |
|---|---|
| PubChem CID | 129409350 |
| Molecular Formula | C23H26N2O |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 2-(1-methylindol-3-yl)-1-[(3S)-3-phenylazepan-1-yl]ethanone |
| SMILES | Cn1cc(CC(=O)N2CCCC[C@@H](c3ccccc3)C2)c2ccccc21 |
| InChI | InChI=1S/C23H26N2O/c1-24-16-20(21-12-5-6-13-22(21)24)15-23(26)25-14-8-7-11-19(17-25)18-9-3-2-4-10-18/h2-6,9-10,12-13,16,19H,7-8,11,14-15,17H2,1H3/t19-/m1/s1 |
| InChIKey | OBPFWJLFJUMCMN-LJQANCHMSA-N |
| XLogP | 4.52 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |