C21H30N3O+ — CID 3634563
1-(4-cyclohexylpiperazin-4-ium-1-yl)-2-(1-methylindol-3-yl)ethanone (PubChem CID 3634563) has the molecular formula C21H30N3O+ and a molecular weight of 340.49 g/mol. Its IUPAC name is 1-(4-cyclohexylpiperazin-4-ium-1-yl)-2-(1-methylindol-3-yl)ethanone.
| Compound Name | 1-(4-cyclohexylpiperazin-4-ium-1-yl)-2-(1-methylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 3634563 |
| Molecular Formula | C21H30N3O+ |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | 1-(4-cyclohexylpiperazin-4-ium-1-yl)-2-(1-methylindol-3-yl)ethanone |
| SMILES | Cn1cc(CC(=O)N2CC[NH+](C3CCCCC3)CC2)c2ccccc21 |
| InChI | InChI=1S/C21H29N3O/c1-22-16-17(19-9-5-6-10-20(19)22)15-21(25)24-13-11-23(12-14-24)18-7-3-2-4-8-18/h5-6,9-10,16,18H,2-4,7-8,11-15H2,1H3/p+1 |
| InChIKey | YWTZCQSHPSOLEA-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 29.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |