C26H31ClN2O — CID 174330791
1-(1-ethylindol-3-yl)-3-[1-(2-phenylethenyl)piperidin-4-yl]propan-1-one;hydrochloride (PubChem CID 174330791) has the molecular formula C26H31ClN2O and a molecular weight of 423.00 g/mol. Its IUPAC name is 1-(1-ethylindol-3-yl)-3-[1-(2-phenylethenyl)piperidin-4-yl]propan-1-one;hydrochloride.
| Compound Name | 1-(1-ethylindol-3-yl)-3-[1-(2-phenylethenyl)piperidin-4-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 174330791 |
| Molecular Formula | C26H31ClN2O |
| Molecular Weight | 423.00 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | 1-(1-ethylindol-3-yl)-3-[1-(2-phenylethenyl)piperidin-4-yl]propan-1-one;hydrochloride |
| SMILES | CCn1cc(C(=O)CCC2CCN(C=Cc3ccccc3)CC2)c2ccccc21.Cl |
| InChI | InChI=1S/C26H30N2O.ClH/c1-2-28-20-24(23-10-6-7-11-25(23)28)26(29)13-12-22-15-18-27(19-16-22)17-14-21-8-4-3-5-9-21;/h3-11,14,17,20,22H,2,12-13,15-16,18-19H2,1H3;1H |
| InChIKey | BWLBDHOFCHLPNK-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.00 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |