C29H36N2O — CID 15581673
1-(2-tert-butylquinolin-4-yl)-3-[1-(2-phenylethyl)piperidin-4-yl]propan-1-one (PubChem CID 15581673) has the molecular formula C29H36N2O and a molecular weight of 428.62 g/mol. Its IUPAC name is 1-(2-tert-butylquinolin-4-yl)-3-[1-(2-phenylethyl)piperidin-4-yl]propan-1-one.
| Compound Name | 1-(2-tert-butylquinolin-4-yl)-3-[1-(2-phenylethyl)piperidin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 15581673 |
| Molecular Formula | C29H36N2O |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 1-(2-tert-butylquinolin-4-yl)-3-[1-(2-phenylethyl)piperidin-4-yl]propan-1-one |
| SMILES | CC(C)(C)c1cc(C(=O)CCC2CCN(CCc3ccccc3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C29H36N2O/c1-29(2,3)28-21-25(24-11-7-8-12-26(24)30-28)27(32)14-13-23-16-19-31(20-17-23)18-15-22-9-5-4-6-10-22/h4-12,21,23H,13-20H2,1-3H3 |
| InChIKey | WFBMBPDMKCHKOW-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |