C16H19NO2 — CID 82499867
3-(7-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propanoic acid (PubChem CID 82499867) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 3-(7-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propanoic acid.
| Compound Name | 3-(7-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propanoic acid |
|---|---|
| PubChem CID | 82499867 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 3-(7-methyl-1,2,3,4-tetrahydrocarbazol-9-yl)propanoic acid |
| SMILES | Cc1ccc2c3c(n(CCC(=O)O)c2c1)CCCC3 |
| InChI | InChI=1S/C16H19NO2/c1-11-6-7-13-12-4-2-3-5-14(12)17(15(13)10-11)9-8-16(18)19/h6-7,10H,2-5,8-9H2,1H3,(H,18,19) |
| InChIKey | IRBGFIJKUOUBBF-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|