C24H26N2O3 — CID 143634258
4-(2-benzoyl-9-methyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)butanoic acid (PubChem CID 143634258) has the molecular formula C24H26N2O3 and a molecular weight of 390.48 g/mol. Its IUPAC name is 4-(2-benzoyl-9-methyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)butanoic acid.
| Compound Name | 4-(2-benzoyl-9-methyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)butanoic acid |
|---|---|
| PubChem CID | 143634258 |
| Molecular Formula | C24H26N2O3 |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 4-(2-benzoyl-9-methyl-1,3,4,5-tetrahydroazepino[4,3-b]indol-6-yl)butanoic acid |
| SMILES | Cc1ccc2c(c1)c1c(n2CCCC(=O)O)CCCN(C(=O)c2ccccc2)C1 |
| InChI | InChI=1S/C24H26N2O3/c1-17-11-12-22-19(15-17)20-16-25(24(29)18-7-3-2-4-8-18)13-5-9-21(20)26(22)14-6-10-23(27)28/h2-4,7-8,11-12,15H,5-6,9-10,13-14,16H2,1H3,(H,27,28) |
| InChIKey | MSXQDGTYGRHMFL-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|