C27H29NO4 — CID 91559387
ethyl 2-[2-[4-(3-methylphenoxy)butoxy]carbazol-9-yl]acetate (PubChem CID 91559387) has the molecular formula C27H29NO4 and a molecular weight of 431.53 g/mol. Its IUPAC name is ethyl 2-[2-[4-(3-methylphenoxy)butoxy]carbazol-9-yl]acetate.
| Compound Name | ethyl 2-[2-[4-(3-methylphenoxy)butoxy]carbazol-9-yl]acetate |
|---|---|
| PubChem CID | 91559387 |
| Molecular Formula | C27H29NO4 |
| Molecular Weight | 431.53 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | ethyl 2-[2-[4-(3-methylphenoxy)butoxy]carbazol-9-yl]acetate |
| SMILES | CCOC(=O)Cn1c2ccccc2c2ccc(OCCCCOc3cccc(C)c3)cc21 |
| InChI | InChI=1S/C27H29NO4/c1-3-30-27(29)19-28-25-12-5-4-11-23(25)24-14-13-22(18-26(24)28)32-16-7-6-15-31-21-10-8-9-20(2)17-21/h4-5,8-14,17-18H,3,6-7,15-16,19H2,1-2H3 |
| InChIKey | LNUIIYWHWQWKJC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.53 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|