C29H34N2O3 — CID 69332968
N,N-diethyl-2-[2-[4-(3-methylphenoxy)butoxy]carbazol-9-yl]acetamide (PubChem CID 69332968) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is N,N-diethyl-2-[2-[4-(3-methylphenoxy)butoxy]carbazol-9-yl]acetamide.
| Compound Name | N,N-diethyl-2-[2-[4-(3-methylphenoxy)butoxy]carbazol-9-yl]acetamide |
|---|---|
| PubChem CID | 69332968 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N,N-diethyl-2-[2-[4-(3-methylphenoxy)butoxy]carbazol-9-yl]acetamide |
| SMILES | CCN(CC)C(=O)Cn1c2ccccc2c2ccc(OCCCCOc3cccc(C)c3)cc21 |
| InChI | InChI=1S/C29H34N2O3/c1-4-30(5-2)29(32)21-31-27-14-7-6-13-25(27)26-16-15-24(20-28(26)31)34-18-9-8-17-33-23-12-10-11-22(3)19-23/h6-7,10-16,19-20H,4-5,8-9,17-18,21H2,1-3H3 |
| InChIKey | REFBSIHIPMMXLJ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 43.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|