C21H24BrNO3 — CID 91291482
ethyl 2-[2-(5-bromopentoxy)carbazol-9-yl]acetate (PubChem CID 91291482) has the molecular formula C21H24BrNO3 and a molecular weight of 418.33 g/mol. Its IUPAC name is ethyl 2-[2-(5-bromopentoxy)carbazol-9-yl]acetate.
| Compound Name | ethyl 2-[2-(5-bromopentoxy)carbazol-9-yl]acetate |
|---|---|
| PubChem CID | 91291482 |
| Molecular Formula | C21H24BrNO3 |
| Molecular Weight | 418.33 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | ethyl 2-[2-(5-bromopentoxy)carbazol-9-yl]acetate |
| SMILES | CCOC(=O)Cn1c2ccccc2c2ccc(OCCCCCBr)cc21 |
| InChI | InChI=1S/C21H24BrNO3/c1-2-25-21(24)15-23-19-9-5-4-8-17(19)18-11-10-16(14-20(18)23)26-13-7-3-6-12-22/h4-5,8-11,14H,2-3,6-7,12-13,15H2,1H3 |
| InChIKey | NXAWTYGDWUYHDQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.33 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|