C21H26Cl2N2O4 — CID 22396677
tert-butyl 8,9-dichloro-6-(2-ethoxy-2-oxoethyl)-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate (PubChem CID 22396677) has the molecular formula C21H26Cl2N2O4 and a molecular weight of 441.36 g/mol. Its IUPAC name is tert-butyl 8,9-dichloro-6-(2-ethoxy-2-oxoethyl)-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate.
| Compound Name | tert-butyl 8,9-dichloro-6-(2-ethoxy-2-oxoethyl)-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 22396677 |
| Molecular Formula | C21H26Cl2N2O4 |
| Molecular Weight | 441.36 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | tert-butyl 8,9-dichloro-6-(2-ethoxy-2-oxoethyl)-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate |
| SMILES | CCOC(=O)Cn1c2c(c3cc(Cl)c(Cl)cc31)CCN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C21H26Cl2N2O4/c1-5-28-19(26)12-25-17-7-9-24(20(27)29-21(2,3)4)8-6-13(17)14-10-15(22)16(23)11-18(14)25/h10-11H,5-9,12H2,1-4H3 |
| InChIKey | PKCMRELWJXZLDX-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.36 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|