C27H31Cl2N3O3 — CID 22396642
tert-butyl 9,10-dichloro-6-[2-(2,3-dimethylanilino)-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate (PubChem CID 22396642) has the molecular formula C27H31Cl2N3O3 and a molecular weight of 516.47 g/mol. Its IUPAC name is tert-butyl 9,10-dichloro-6-[2-(2,3-dimethylanilino)-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate.
| Compound Name | tert-butyl 9,10-dichloro-6-[2-(2,3-dimethylanilino)-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 22396642 |
| Molecular Formula | C27H31Cl2N3O3 |
| Molecular Weight | 516.47 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | tert-butyl 9,10-dichloro-6-[2-(2,3-dimethylanilino)-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate |
| SMILES | Cc1cccc(NC(=O)Cn2c3c(c4c(Cl)c(Cl)ccc42)CCN(C(=O)OC(C)(C)C)CC3)c1C |
| InChI | InChI=1S/C27H31Cl2N3O3/c1-16-7-6-8-20(17(16)2)30-23(33)15-32-21-12-14-31(26(34)35-27(3,4)5)13-11-18(21)24-22(32)10-9-19(28)25(24)29/h6-10H,11-15H2,1-5H3,(H,30,33) |
| InChIKey | PEEGALACJXRCIJ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.47 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |