C22H23Cl2N3O — CID 22396555
2-(7,9-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)-N-(2,3-dimethylphenyl)acetamide (PubChem CID 22396555) has the molecular formula C22H23Cl2N3O and a molecular weight of 416.35 g/mol. Its IUPAC name is 2-(7,9-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)-N-(2,3-dimethylphenyl)acetamide.
| Compound Name | 2-(7,9-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)-N-(2,3-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 22396555 |
| Molecular Formula | C22H23Cl2N3O |
| Molecular Weight | 416.35 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | 2-(7,9-dichloro-2,3,4,5-tetrahydro-1H-azepino[4,5-b]indol-6-yl)-N-(2,3-dimethylphenyl)acetamide |
| SMILES | Cc1cccc(NC(=O)Cn2c3c(c4cc(Cl)cc(Cl)c42)CCNCC3)c1C |
| InChI | InChI=1S/C22H23Cl2N3O/c1-13-4-3-5-19(14(13)2)26-21(28)12-27-20-7-9-25-8-6-16(20)17-10-15(23)11-18(24)22(17)27/h3-5,10-11,25H,6-9,12H2,1-2H3,(H,26,28) |
| InChIKey | JVCMJSQOEKPMQI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|