C23H27BrN4O3S — CID 22396948
tert-butyl 7-bromo-6-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate (PubChem CID 22396948) has the molecular formula C23H27BrN4O3S and a molecular weight of 519.47 g/mol. Its IUPAC name is tert-butyl 7-bromo-6-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate.
| Compound Name | tert-butyl 7-bromo-6-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 22396948 |
| Molecular Formula | C23H27BrN4O3S |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | tert-butyl 7-bromo-6-[2-[(4-methyl-1,3-thiazol-2-yl)amino]-2-oxoethyl]-1,2,4,5-tetrahydroazepino[4,5-b]indole-3-carboxylate |
| SMILES | Cc1csc(NC(=O)Cn2c3c(c4cccc(Br)c42)CCN(C(=O)OC(C)(C)C)CC3)n1 |
| InChI | InChI=1S/C23H27BrN4O3S/c1-14-13-32-21(25-14)26-19(29)12-28-18-9-11-27(22(30)31-23(2,3)4)10-8-15(18)16-6-5-7-17(24)20(16)28/h5-7,13H,8-12H2,1-4H3,(H,25,26,29) |
| InChIKey | RJUBZCYAXMWOHH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|