C15H21ClN4O4 — CID 147472061
tert-butyl 4-chloro-1-(2-hydrazinylacetyl)-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate (PubChem CID 147472061) has the molecular formula C15H21ClN4O4 and a molecular weight of 356.81 g/mol. Its IUPAC name is tert-butyl 4-chloro-1-(2-hydrazinylacetyl)-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate.
| Compound Name | tert-butyl 4-chloro-1-(2-hydrazinylacetyl)-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
|---|---|
| PubChem CID | 147472061 |
| Molecular Formula | C15H21ClN4O4 |
| Molecular Weight | 356.81 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | tert-butyl 4-chloro-1-(2-hydrazinylacetyl)-2-oxo-7,8-dihydro-5H-1,6-naphthyridine-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(c(Cl)cc(=O)n2C(=O)CNN)C1 |
| InChI | InChI=1S/C15H21ClN4O4/c1-15(2,3)24-14(23)19-5-4-11-9(8-19)10(16)6-12(21)20(11)13(22)7-18-17/h6,18H,4-5,7-8,17H2,1-3H3 |
| InChIKey | FBYYPSJQLWGETF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 106.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.81 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|