C18H26N2O5 — CID 11152294
ditert-butyl 2-formyl-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-1,5-dicarboxylate (PubChem CID 11152294) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is ditert-butyl 2-formyl-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-1,5-dicarboxylate.
| Compound Name | ditert-butyl 2-formyl-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-1,5-dicarboxylate |
|---|---|
| PubChem CID | 11152294 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | ditert-butyl 2-formyl-6,7-dihydro-4H-pyrrolo[3,2-c]pyridine-1,5-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(cc(C=O)n2C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C18H26N2O5/c1-17(2,3)24-15(22)19-8-7-14-12(10-19)9-13(11-21)20(14)16(23)25-18(4,5)6/h9,11H,7-8,10H2,1-6H3 |
| InChIKey | LNRDBXAKRKFDMG-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|