C16H13Cl2N — CID 63812577
1-[(3,4-dichlorophenyl)methyl]-2-methylindole (PubChem CID 63812577) has the molecular formula C16H13Cl2N and a molecular weight of 290.19 g/mol. Its IUPAC name is 1-[(3,4-dichlorophenyl)methyl]-2-methylindole.
| Compound Name | 1-[(3,4-dichlorophenyl)methyl]-2-methylindole |
|---|---|
| PubChem CID | 63812577 |
| Molecular Formula | C16H13Cl2N |
| Molecular Weight | 290.19 g/mol |
| Exact Mass | 289.04 |
| IUPAC Name | 1-[(3,4-dichlorophenyl)methyl]-2-methylindole |
| SMILES | Cc1cc2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H13Cl2N/c1-11-8-13-4-2-3-5-16(13)19(11)10-12-6-7-14(17)15(18)9-12/h2-9H,10H2,1H3 |
| InChIKey | QJYYTGNRHKBUPU-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.19 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |