About 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate
3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate (PubChem CID 70551057) has the molecular formula C19H20Cl2N2O3
and a molecular weight of 395.29 g/mol. Its IUPAC name is 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate.
Molecular Properties
| Compound Name | 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate |
| PubChem CID | 70551057 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate |
| SMILES | CCOC(=O)CC.O=c1[nH]c2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H10Cl2N2O.C5H10O2/c15-10-6-5-9(7-11(10)16)8-18-13-4-2-1-3-12(13)17-14(18)19;1-3-5(6)7-4-2/h1-7H,8H2,(H,17,19);3-4H2,1-2H3 |
| InChIKey | JRDSKECMOQXIHP-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate?
The IUPAC name of 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate (CID 70551057) is 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate.
What is the SMILES notation for 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate?
The canonical SMILES for 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate is CCOC(=O)CC.O=c1[nH]c2ccccc2n1Cc1ccc(Cl)c(Cl)c1.
What is the InChIKey of 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate?
The InChIKey is JRDSKECMOQXIHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Cl2N2O.C5H10O2/c15-10-6-5-9(7-11(10)16)8-18-13-4-2-1-3-12(13)17-14(18)19;1-3-5(6)7-4-2/h1-7H,8H2,(H,17,19);3-4H2,1-2H3.
What are the key properties of 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate?
3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate has a molecular weight of 395.29 g/mol, XLogP of 4.64, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3,4-dichlorophenyl)methyl]-1H-benzimidazol-2-one;ethyl propanoate is sourced from PubChem (CID 70551057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).