C24H24N2O5 — CID 10002213
ethyl 3-[(Z)-2-acetamido-3-methoxy-3-oxoprop-1-enyl]-1-benzylindole-2-carboxylate (PubChem CID 10002213) has the molecular formula C24H24N2O5 and a molecular weight of 420.47 g/mol. Its IUPAC name is ethyl 3-[(Z)-2-acetamido-3-methoxy-3-oxoprop-1-enyl]-1-benzylindole-2-carboxylate.
| Compound Name | ethyl 3-[(Z)-2-acetamido-3-methoxy-3-oxoprop-1-enyl]-1-benzylindole-2-carboxylate |
|---|---|
| PubChem CID | 10002213 |
| Molecular Formula | C24H24N2O5 |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.17 |
| IUPAC Name | ethyl 3-[(Z)-2-acetamido-3-methoxy-3-oxoprop-1-enyl]-1-benzylindole-2-carboxylate |
| SMILES | CCOC(=O)c1c(/C=C(\NC(C)=O)C(=O)OC)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C24H24N2O5/c1-4-31-24(29)22-19(14-20(23(28)30-3)25-16(2)27)18-12-8-9-13-21(18)26(22)15-17-10-6-5-7-11-17/h5-14H,4,15H2,1-3H3,(H,25,27)/b20-14- |
| InChIKey | OLEAUVFPOUHIDN-ZHZULCJRSA-N |
| XLogP | 3.52 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|