C20H32N4O3Si — CID 177070458
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methyl-4-phenylmethoxypyrazole-5-carbohydrazide (PubChem CID 177070458) has the molecular formula C20H32N4O3Si and a molecular weight of 404.59 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methyl-4-phenylmethoxypyrazole-5-carbohydrazide.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methyl-4-phenylmethoxypyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 177070458 |
| Molecular Formula | C20H32N4O3Si |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-methyl-4-phenylmethoxypyrazole-5-carbohydrazide |
| SMILES | Cc1nn(CCO[Si](C)(C)C(C)(C)C)c(C(=O)NN)c1OCc1ccccc1 |
| InChI | InChI=1S/C20H32N4O3Si/c1-15-18(26-14-16-10-8-7-9-11-16)17(19(25)22-21)24(23-15)12-13-27-28(5,6)20(2,3)4/h7-11H,12-14,21H2,1-6H3,(H,22,25) |
| InChIKey | VTCTZYGHINSGGT-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|