C23H33NO5Si — CID 88612540
6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylmethoxy-N-propan-2-ylpyran-2-carboxamide (PubChem CID 88612540) has the molecular formula C23H33NO5Si and a molecular weight of 431.61 g/mol. Its IUPAC name is 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylmethoxy-N-propan-2-ylpyran-2-carboxamide.
| Compound Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylmethoxy-N-propan-2-ylpyran-2-carboxamide |
|---|---|
| PubChem CID | 88612540 |
| Molecular Formula | C23H33NO5Si |
| Molecular Weight | 431.61 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-3-phenylmethoxy-N-propan-2-ylpyran-2-carboxamide |
| SMILES | CC(C)NC(=O)c1oc(CO[Si](C)(C)C(C)(C)C)cc(=O)c1OCc1ccccc1 |
| InChI | InChI=1S/C23H33NO5Si/c1-16(2)24-22(26)21-20(27-14-17-11-9-8-10-12-17)19(25)13-18(29-21)15-28-30(6,7)23(3,4)5/h8-13,16H,14-15H2,1-7H3,(H,24,26) |
| InChIKey | LBENNMXJMPLTSK-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.61 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|