C20H36N2O4Si — CID 155631123
3-butoxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-N-propan-2-yl-1H-pyridine-2-carboxamide (PubChem CID 155631123) has the molecular formula C20H36N2O4Si and a molecular weight of 396.60 g/mol. Its IUPAC name is 3-butoxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-N-propan-2-yl-1H-pyridine-2-carboxamide.
| Compound Name | 3-butoxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-N-propan-2-yl-1H-pyridine-2-carboxamide |
|---|---|
| PubChem CID | 155631123 |
| Molecular Formula | C20H36N2O4Si |
| Molecular Weight | 396.60 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | 3-butoxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-oxo-N-propan-2-yl-1H-pyridine-2-carboxamide |
| SMILES | CCCCOc1c(C(=O)NC(C)C)[nH]c(CO[Si](C)(C)C(C)(C)C)cc1=O |
| InChI | InChI=1S/C20H36N2O4Si/c1-9-10-11-25-18-16(23)12-15(13-26-27(7,8)20(4,5)6)22-17(18)19(24)21-14(2)3/h12,14H,9-11,13H2,1-8H3,(H,21,24)(H,22,23) |
| InChIKey | QLIIONXCDBKBGW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.60 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|