C16H24ClN3O3S — CID 7977955
1-[(4-butoxy-3-chloro-5-methoxybenzoyl)amino]-3-propan-2-ylthiourea (PubChem CID 7977955) has the molecular formula C16H24ClN3O3S and a molecular weight of 373.91 g/mol. Its IUPAC name is 1-[(4-butoxy-3-chloro-5-methoxybenzoyl)amino]-3-propan-2-ylthiourea.
| Compound Name | 1-[(4-butoxy-3-chloro-5-methoxybenzoyl)amino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 7977955 |
| Molecular Formula | C16H24ClN3O3S |
| Molecular Weight | 373.91 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[(4-butoxy-3-chloro-5-methoxybenzoyl)amino]-3-propan-2-ylthiourea |
| SMILES | CCCCOc1c(Cl)cc(C(=O)NNC(=S)NC(C)C)cc1OC |
| InChI | InChI=1S/C16H24ClN3O3S/c1-5-6-7-23-14-12(17)8-11(9-13(14)22-4)15(21)19-20-16(24)18-10(2)3/h8-10H,5-7H2,1-4H3,(H,19,21)(H2,18,20,24) |
| InChIKey | PVUNYLVVNGMUSO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.91 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|