C20H22ClN3O5S — CID 24637405
1-(1,3-benzodioxol-5-ylmethyl)-3-[(3-chloro-5-methoxy-4-propoxybenzoyl)amino]thiourea (PubChem CID 24637405) has the molecular formula C20H22ClN3O5S and a molecular weight of 451.93 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[(3-chloro-5-methoxy-4-propoxybenzoyl)amino]thiourea.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(3-chloro-5-methoxy-4-propoxybenzoyl)amino]thiourea |
|---|---|
| PubChem CID | 24637405 |
| Molecular Formula | C20H22ClN3O5S |
| Molecular Weight | 451.93 g/mol |
| Exact Mass | 451.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[(3-chloro-5-methoxy-4-propoxybenzoyl)amino]thiourea |
| SMILES | CCCOc1c(Cl)cc(C(=O)NNC(=S)NCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C20H22ClN3O5S/c1-3-6-27-18-14(21)8-13(9-17(18)26-2)19(25)23-24-20(30)22-10-12-4-5-15-16(7-12)29-11-28-15/h4-5,7-9H,3,6,10-11H2,1-2H3,(H,23,25)(H2,22,24,30) |
| InChIKey | CYLFHHVVODYTCZ-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 90.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|